About butan-2-yl 4-methoxybutanoate
butan-2-yl 4-methoxybutanoate (PubChem CID 134215761) has the molecular formula C9H18O3
and a molecular weight of 174.24 g/mol. Its IUPAC name is butan-2-yl 4-methoxybutanoate.
Molecular Properties
| Compound Name | butan-2-yl 4-methoxybutanoate |
| PubChem CID | 134215761 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | butan-2-yl 4-methoxybutanoate |
| SMILES | CCC(C)OC(=O)CCCOC |
| InChI | InChI=1S/C9H18O3/c1-4-8(2)12-9(10)6-5-7-11-3/h8H,4-7H2,1-3H3 |
| InChIKey | GYMVOUZFQUFJGO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butan-2-yl 4-methoxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yl 4-methoxybutanoate?
The IUPAC name of butan-2-yl 4-methoxybutanoate (CID 134215761) is butan-2-yl 4-methoxybutanoate.
What is the SMILES notation for butan-2-yl 4-methoxybutanoate?
The canonical SMILES for butan-2-yl 4-methoxybutanoate is CCC(C)OC(=O)CCCOC.
What is the InChIKey of butan-2-yl 4-methoxybutanoate?
The InChIKey is GYMVOUZFQUFJGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O3/c1-4-8(2)12-9(10)6-5-7-11-3/h8H,4-7H2,1-3H3.
What are the key properties of butan-2-yl 4-methoxybutanoate?
butan-2-yl 4-methoxybutanoate has a molecular weight of 174.24 g/mol, XLogP of 1.75, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl 4-methoxybutanoate is sourced from PubChem (CID 134215761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).