About bromo 4-methylhexanoate
bromo 4-methylhexanoate (PubChem CID 174730777) has the molecular formula C7H13BrO2
and a molecular weight of 209.08 g/mol. Its IUPAC name is bromo 4-methylhexanoate.
Molecular Properties
| Compound Name | bromo 4-methylhexanoate |
| PubChem CID | 174730777 |
| Molecular Formula | C7H13BrO2 |
| Molecular Weight | 209.08 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | bromo 4-methylhexanoate |
| SMILES | CCC(C)CCC(=O)OBr |
| InChI | InChI=1S/C7H13BrO2/c1-3-6(2)4-5-7(9)10-8/h6H,3-5H2,1-2H3 |
| InChIKey | FTFHCGIUBBZZKN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.08 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bromo 4-methylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromo 4-methylhexanoate?
The IUPAC name of bromo 4-methylhexanoate (CID 174730777) is bromo 4-methylhexanoate.
What is the SMILES notation for bromo 4-methylhexanoate?
The canonical SMILES for bromo 4-methylhexanoate is CCC(C)CCC(=O)OBr.
What is the InChIKey of bromo 4-methylhexanoate?
The InChIKey is FTFHCGIUBBZZKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13BrO2/c1-3-6(2)4-5-7(9)10-8/h6H,3-5H2,1-2H3.
What are the key properties of bromo 4-methylhexanoate?
bromo 4-methylhexanoate has a molecular weight of 209.08 g/mol, XLogP of 2.67, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bromo 4-methylhexanoate is sourced from PubChem (CID 174730777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).