About (propyltrisulfanyl) 4-methylhexanoate
(propyltrisulfanyl) 4-methylhexanoate (PubChem CID 175105577) has the molecular formula C10H20O2S3
and a molecular weight of 268.47 g/mol. Its IUPAC name is (propyltrisulfanyl) 4-methylhexanoate.
Molecular Properties
| Compound Name | (propyltrisulfanyl) 4-methylhexanoate |
| PubChem CID | 175105577 |
| Molecular Formula | C10H20O2S3 |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | (propyltrisulfanyl) 4-methylhexanoate |
| SMILES | CCCSSSOC(=O)CCC(C)CC |
| InChI | InChI=1S/C10H20O2S3/c1-4-8-13-15-14-12-10(11)7-6-9(3)5-2/h9H,4-8H2,1-3H3 |
| InChIKey | FOWBCFRDPRROAC-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (propyltrisulfanyl) 4-methylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (propyltrisulfanyl) 4-methylhexanoate?
The IUPAC name of (propyltrisulfanyl) 4-methylhexanoate (CID 175105577) is (propyltrisulfanyl) 4-methylhexanoate.
What is the SMILES notation for (propyltrisulfanyl) 4-methylhexanoate?
The canonical SMILES for (propyltrisulfanyl) 4-methylhexanoate is CCCSSSOC(=O)CCC(C)CC.
What is the InChIKey of (propyltrisulfanyl) 4-methylhexanoate?
The InChIKey is FOWBCFRDPRROAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2S3/c1-4-8-13-15-14-12-10(11)7-6-9(3)5-2/h9H,4-8H2,1-3H3.
What are the key properties of (propyltrisulfanyl) 4-methylhexanoate?
(propyltrisulfanyl) 4-methylhexanoate has a molecular weight of 268.47 g/mol, XLogP of 4.71, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (propyltrisulfanyl) 4-methylhexanoate is sourced from PubChem (CID 175105577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).