About 1-(dimethylamino)ethyl 2-methylprop-2-enoate;hydrobromide
1-(dimethylamino)ethyl 2-methylprop-2-enoate;hydrobromide (PubChem CID 19073826) has the molecular formula C8H16BrNO2
and a molecular weight of 238.12 g/mol. Its IUPAC name is 1-(dimethylamino)ethyl 2-methylprop-2-enoate;hydrobromide.
Molecular Properties
| Compound Name | 1-(dimethylamino)ethyl 2-methylprop-2-enoate;hydrobromide |
| PubChem CID | 19073826 |
| Molecular Formula | C8H16BrNO2 |
| Molecular Weight | 238.12 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 1-(dimethylamino)ethyl 2-methylprop-2-enoate;hydrobromide |
| SMILES | Br.C=C(C)C(=O)OC(C)N(C)C |
| InChI | InChI=1S/C8H15NO2.BrH/c1-6(2)8(10)11-7(3)9(4)5;/h7H,1H2,2-5H3;1H |
| InChIKey | RNWHAEHCFDGKED-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.12 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(dimethylamino)ethyl 2-methylprop-2-enoate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylamino)ethyl 2-methylprop-2-enoate;hydrobromide?
The IUPAC name of 1-(dimethylamino)ethyl 2-methylprop-2-enoate;hydrobromide (CID 19073826) is 1-(dimethylamino)ethyl 2-methylprop-2-enoate;hydrobromide.
What is the SMILES notation for 1-(dimethylamino)ethyl 2-methylprop-2-enoate;hydrobromide?
The canonical SMILES for 1-(dimethylamino)ethyl 2-methylprop-2-enoate;hydrobromide is Br.C=C(C)C(=O)OC(C)N(C)C.
What is the InChIKey of 1-(dimethylamino)ethyl 2-methylprop-2-enoate;hydrobromide?
The InChIKey is RNWHAEHCFDGKED-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2.BrH/c1-6(2)8(10)11-7(3)9(4)5;/h7H,1H2,2-5H3;1H.
What are the key properties of 1-(dimethylamino)ethyl 2-methylprop-2-enoate;hydrobromide?
1-(dimethylamino)ethyl 2-methylprop-2-enoate;hydrobromide has a molecular weight of 238.12 g/mol, XLogP of 1.59, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylamino)ethyl 2-methylprop-2-enoate;hydrobromide is sourced from PubChem (CID 19073826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).