About 1-(dimethylamino)ethyl 2-methylprop-2-enoate;2-methylhex-2-enamide
1-(dimethylamino)ethyl 2-methylprop-2-enoate;2-methylhex-2-enamide (PubChem CID 174925425) has the molecular formula C15H28N2O3
and a molecular weight of 284.40 g/mol. Its IUPAC name is 1-(dimethylamino)ethyl 2-methylprop-2-enoate;2-methylhex-2-enamide.
Molecular Properties
| Compound Name | 1-(dimethylamino)ethyl 2-methylprop-2-enoate;2-methylhex-2-enamide |
| PubChem CID | 174925425 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 1-(dimethylamino)ethyl 2-methylprop-2-enoate;2-methylhex-2-enamide |
| SMILES | C=C(C)C(=O)OC(C)N(C)C.CCCC=C(C)C(N)=O |
| InChI | InChI=1S/C8H15NO2.C7H13NO/c1-6(2)8(10)11-7(3)9(4)5;1-3-4-5-6(2)7(8)9/h7H,1H2,2-5H3;5H,3-4H2,1-2H3,(H2,8,9) |
| InChIKey | KANDRCFHLNRDEN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(dimethylamino)ethyl 2-methylprop-2-enoate;2-methylhex-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylamino)ethyl 2-methylprop-2-enoate;2-methylhex-2-enamide?
The IUPAC name of 1-(dimethylamino)ethyl 2-methylprop-2-enoate;2-methylhex-2-enamide (CID 174925425) is 1-(dimethylamino)ethyl 2-methylprop-2-enoate;2-methylhex-2-enamide.
What is the SMILES notation for 1-(dimethylamino)ethyl 2-methylprop-2-enoate;2-methylhex-2-enamide?
The canonical SMILES for 1-(dimethylamino)ethyl 2-methylprop-2-enoate;2-methylhex-2-enamide is C=C(C)C(=O)OC(C)N(C)C.CCCC=C(C)C(N)=O.
What is the InChIKey of 1-(dimethylamino)ethyl 2-methylprop-2-enoate;2-methylhex-2-enamide?
The InChIKey is KANDRCFHLNRDEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2.C7H13NO/c1-6(2)8(10)11-7(3)9(4)5;1-3-4-5-6(2)7(8)9/h7H,1H2,2-5H3;5H,3-4H2,1-2H3,(H2,8,9).
What are the key properties of 1-(dimethylamino)ethyl 2-methylprop-2-enoate;2-methylhex-2-enamide?
1-(dimethylamino)ethyl 2-methylprop-2-enoate;2-methylhex-2-enamide has a molecular weight of 284.40 g/mol, XLogP of 2.23, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylamino)ethyl 2-methylprop-2-enoate;2-methylhex-2-enamide is sourced from PubChem (CID 174925425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).