About 1-(dimethylamino)ethyl 4-hydroxy-2-methylhex-2-enoate;hydrochloride
1-(dimethylamino)ethyl 4-hydroxy-2-methylhex-2-enoate;hydrochloride (PubChem CID 173070429) has the molecular formula C11H22ClNO3
and a molecular weight of 251.75 g/mol. Its IUPAC name is 1-(dimethylamino)ethyl 4-hydroxy-2-methylhex-2-enoate;hydrochloride.
Molecular Properties
| Compound Name | 1-(dimethylamino)ethyl 4-hydroxy-2-methylhex-2-enoate;hydrochloride |
| PubChem CID | 173070429 |
| Molecular Formula | C11H22ClNO3 |
| Molecular Weight | 251.75 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 1-(dimethylamino)ethyl 4-hydroxy-2-methylhex-2-enoate;hydrochloride |
| SMILES | CCC(O)C=C(C)C(=O)OC(C)N(C)C.Cl |
| InChI | InChI=1S/C11H21NO3.ClH/c1-6-10(13)7-8(2)11(14)15-9(3)12(4)5;/h7,9-10,13H,6H2,1-5H3;1H |
| InChIKey | QLHZYNWRYUJROC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.75 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(dimethylamino)ethyl 4-hydroxy-2-methylhex-2-enoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylamino)ethyl 4-hydroxy-2-methylhex-2-enoate;hydrochloride?
The IUPAC name of 1-(dimethylamino)ethyl 4-hydroxy-2-methylhex-2-enoate;hydrochloride (CID 173070429) is 1-(dimethylamino)ethyl 4-hydroxy-2-methylhex-2-enoate;hydrochloride.
What is the SMILES notation for 1-(dimethylamino)ethyl 4-hydroxy-2-methylhex-2-enoate;hydrochloride?
The canonical SMILES for 1-(dimethylamino)ethyl 4-hydroxy-2-methylhex-2-enoate;hydrochloride is CCC(O)C=C(C)C(=O)OC(C)N(C)C.Cl.
What is the InChIKey of 1-(dimethylamino)ethyl 4-hydroxy-2-methylhex-2-enoate;hydrochloride?
The InChIKey is QLHZYNWRYUJROC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3.ClH/c1-6-10(13)7-8(2)11(14)15-9(3)12(4)5;/h7,9-10,13H,6H2,1-5H3;1H.
What are the key properties of 1-(dimethylamino)ethyl 4-hydroxy-2-methylhex-2-enoate;hydrochloride?
1-(dimethylamino)ethyl 4-hydroxy-2-methylhex-2-enoate;hydrochloride has a molecular weight of 251.75 g/mol, XLogP of 1.58, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylamino)ethyl 4-hydroxy-2-methylhex-2-enoate;hydrochloride is sourced from PubChem (CID 173070429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).