C12H23NO2 — CID 88573956
ethyl (E)-4-(dimethylamino)-2,5-dimethylhex-2-enoate (PubChem CID 88573956) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is ethyl (E)-4-(dimethylamino)-2,5-dimethylhex-2-enoate.
| Compound Name | ethyl (E)-4-(dimethylamino)-2,5-dimethylhex-2-enoate |
|---|---|
| PubChem CID | 88573956 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | ethyl (E)-4-(dimethylamino)-2,5-dimethylhex-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/C(C(C)C)N(C)C |
| InChI | InChI=1S/C12H23NO2/c1-7-15-12(14)10(4)8-11(9(2)3)13(5)6/h8-9,11H,7H2,1-6H3/b10-8+ |
| InChIKey | ZZXKEOFDSZANEN-CSKARUKUSA-N |
| XLogP | 2.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|