C12H21BNO3 — CID 123724512
CID 123724512 (PubChem CID 123724512) has the molecular formula C12H21BNO3 and a molecular weight of 238.12 g/mol.
| Compound Name | CID 123724512 |
|---|---|
| PubChem CID | 123724512 |
| Molecular Formula | C12H21BNO3 |
| Molecular Weight | 238.12 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | — |
| SMILES | CCOC(=O)C(C)=C[C@H](C(C)C)N(C)[B]C=O |
| InChI | InChI=1S/C12H21BNO3/c1-6-17-12(16)10(4)7-11(9(2)3)14(5)13-8-15/h7-9,11H,6H2,1-5H3/t11-/m1/s1 |
| InChIKey | QYNPIFCTCYZOHI-LLVKDONJSA-N |
| XLogP | 1.26 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.12 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|