C11H22ClNO2 — CID 138108121
ethyl 2,5-dimethyl-4-(methylamino)hex-2-enoate;hydrochloride (PubChem CID 138108121) has the molecular formula C11H22ClNO2 and a molecular weight of 235.75 g/mol. Its IUPAC name is ethyl 2,5-dimethyl-4-(methylamino)hex-2-enoate;hydrochloride.
| Compound Name | ethyl 2,5-dimethyl-4-(methylamino)hex-2-enoate;hydrochloride |
|---|---|
| PubChem CID | 138108121 |
| Molecular Formula | C11H22ClNO2 |
| Molecular Weight | 235.75 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | ethyl 2,5-dimethyl-4-(methylamino)hex-2-enoate;hydrochloride |
| SMILES | CCOC(=O)C(C)=CC(NC)C(C)C.Cl |
| InChI | InChI=1S/C11H21NO2.ClH/c1-6-14-11(13)9(4)7-10(12-5)8(2)3;/h7-8,10,12H,6H2,1-5H3;1H |
| InChIKey | DOGUQADNNOKYBX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.75 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|