About azane;ethyl 4-amino-2-methylhex-2-enoate
azane;ethyl 4-amino-2-methylhex-2-enoate (PubChem CID 173072927) has the molecular formula C9H20N2O2
and a molecular weight of 188.27 g/mol. Its IUPAC name is azane;ethyl 4-amino-2-methylhex-2-enoate.
Molecular Properties
| Compound Name | azane;ethyl 4-amino-2-methylhex-2-enoate |
| PubChem CID | 173072927 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | azane;ethyl 4-amino-2-methylhex-2-enoate |
| SMILES | CCOC(=O)C(C)=CC(N)CC.N |
| InChI | InChI=1S/C9H17NO2.H3N/c1-4-8(10)6-7(3)9(11)12-5-2;/h6,8H,4-5,10H2,1-3H3;1H3 |
| InChIKey | VDTZQVOYSJWIGK-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze azane;ethyl 4-amino-2-methylhex-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;ethyl 4-amino-2-methylhex-2-enoate?
The IUPAC name of azane;ethyl 4-amino-2-methylhex-2-enoate (CID 173072927) is azane;ethyl 4-amino-2-methylhex-2-enoate.
What is the SMILES notation for azane;ethyl 4-amino-2-methylhex-2-enoate?
The canonical SMILES for azane;ethyl 4-amino-2-methylhex-2-enoate is CCOC(=O)C(C)=CC(N)CC.N.
What is the InChIKey of azane;ethyl 4-amino-2-methylhex-2-enoate?
The InChIKey is VDTZQVOYSJWIGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2.H3N/c1-4-8(10)6-7(3)9(11)12-5-2;/h6,8H,4-5,10H2,1-3H3;1H3.
What are the key properties of azane;ethyl 4-amino-2-methylhex-2-enoate?
azane;ethyl 4-amino-2-methylhex-2-enoate has a molecular weight of 188.27 g/mol, XLogP of 1.40, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;ethyl 4-amino-2-methylhex-2-enoate is sourced from PubChem (CID 173072927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).