C24H44N2O3 — CID 58650324
ethyl (E,4S)-4-[[(E,2R,5R)-6,6-dimethyl-5-(methylamino)-2-propan-2-ylhept-3-enoyl]-methylamino]-2,5-dimethylhex-2-enoate (PubChem CID 58650324) has the molecular formula C24H44N2O3 and a molecular weight of 408.63 g/mol. Its IUPAC name is ethyl (E,4S)-4-[[(E,2R,5R)-6,6-dimethyl-5-(methylamino)-2-propan-2-ylhept-3-enoyl]-methylamino]-2,5-dimethylhex-2-enoate.
| Compound Name | ethyl (E,4S)-4-[[(E,2R,5R)-6,6-dimethyl-5-(methylamino)-2-propan-2-ylhept-3-enoyl]-methylamino]-2,5-dimethylhex-2-enoate |
|---|---|
| PubChem CID | 58650324 |
| Molecular Formula | C24H44N2O3 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.34 |
| IUPAC Name | ethyl (E,4S)-4-[[(E,2R,5R)-6,6-dimethyl-5-(methylamino)-2-propan-2-ylhept-3-enoyl]-methylamino]-2,5-dimethylhex-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/[C@H](C(C)C)N(C)C(=O)[C@@H](/C=C/[C@@H](NC)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C24H44N2O3/c1-12-29-23(28)18(6)15-20(17(4)5)26(11)22(27)19(16(2)3)13-14-21(25-10)24(7,8)9/h13-17,19-21,25H,12H2,1-11H3/b14-13+,18-15+/t19-,20+,21+/m0/s1 |
| InChIKey | RDVYBELHHMXITL-SHBYFEKFSA-N |
| XLogP | 4.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|