C15H23F3N2O4 — CID 123535941
ethyl (4S)-2,5-dimethyl-4-[methyl-[2-[(2,2,2-trifluoroacetyl)amino]acetyl]amino]hex-2-enoate (PubChem CID 123535941) has the molecular formula C15H23F3N2O4 and a molecular weight of 352.35 g/mol. Its IUPAC name is ethyl (4S)-2,5-dimethyl-4-[methyl-[2-[(2,2,2-trifluoroacetyl)amino]acetyl]amino]hex-2-enoate.
| Compound Name | ethyl (4S)-2,5-dimethyl-4-[methyl-[2-[(2,2,2-trifluoroacetyl)amino]acetyl]amino]hex-2-enoate |
|---|---|
| PubChem CID | 123535941 |
| Molecular Formula | C15H23F3N2O4 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | ethyl (4S)-2,5-dimethyl-4-[methyl-[2-[(2,2,2-trifluoroacetyl)amino]acetyl]amino]hex-2-enoate |
| SMILES | CCOC(=O)C(C)=C[C@H](C(C)C)N(C)C(=O)CNC(=O)C(F)(F)F |
| InChI | InChI=1S/C15H23F3N2O4/c1-6-24-13(22)10(4)7-11(9(2)3)20(5)12(21)8-19-14(23)15(16,17)18/h7,9,11H,6,8H2,1-5H3,(H,19,23)/t11-/m1/s1 |
| InChIKey | RBVPFKXGHTXWGI-LLVKDONJSA-N |
| XLogP | 1.66 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|