C21H38N2O4 — CID 160624218
ethyl (E,4S)-4-[[2-(2,2-diethylbutanoylamino)acetyl]-methylamino]-2,5-dimethylhex-2-enoate (PubChem CID 160624218) has the molecular formula C21H38N2O4 and a molecular weight of 382.55 g/mol. Its IUPAC name is ethyl (E,4S)-4-[[2-(2,2-diethylbutanoylamino)acetyl]-methylamino]-2,5-dimethylhex-2-enoate.
| Compound Name | ethyl (E,4S)-4-[[2-(2,2-diethylbutanoylamino)acetyl]-methylamino]-2,5-dimethylhex-2-enoate |
|---|---|
| PubChem CID | 160624218 |
| Molecular Formula | C21H38N2O4 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.28 |
| IUPAC Name | ethyl (E,4S)-4-[[2-(2,2-diethylbutanoylamino)acetyl]-methylamino]-2,5-dimethylhex-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/[C@H](C(C)C)N(C)C(=O)CNC(=O)C(CC)(CC)CC |
| InChI | InChI=1S/C21H38N2O4/c1-9-21(10-2,11-3)20(26)22-14-18(24)23(8)17(15(5)6)13-16(7)19(25)27-12-4/h13,15,17H,9-12,14H2,1-8H3,(H,22,26)/b16-13+/t17-/m1/s1 |
| InChIKey | KFAPUILKZNTDDK-HJUDDPQBSA-N |
| XLogP | 3.31 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|