C27H50N2O4 — CID 148563130
ethyl (E,4S)-4-[[(2S,3S)-2-(2,2-diethylhexanoylamino)-3-methylpentanoyl]-methylamino]-2,5-dimethylhex-2-enoate (PubChem CID 148563130) has the molecular formula C27H50N2O4 and a molecular weight of 466.71 g/mol. Its IUPAC name is ethyl (E,4S)-4-[[(2S,3S)-2-(2,2-diethylhexanoylamino)-3-methylpentanoyl]-methylamino]-2,5-dimethylhex-2-enoate.
| Compound Name | ethyl (E,4S)-4-[[(2S,3S)-2-(2,2-diethylhexanoylamino)-3-methylpentanoyl]-methylamino]-2,5-dimethylhex-2-enoate |
|---|---|
| PubChem CID | 148563130 |
| Molecular Formula | C27H50N2O4 |
| Molecular Weight | 466.71 g/mol |
| Exact Mass | 466.38 |
| IUPAC Name | ethyl (E,4S)-4-[[(2S,3S)-2-(2,2-diethylhexanoylamino)-3-methylpentanoyl]-methylamino]-2,5-dimethylhex-2-enoate |
| SMILES | CCCCC(CC)(CC)C(=O)N[C@H](C(=O)N(C)[C@H](/C=C(\C)C(=O)OCC)C(C)C)[C@@H](C)CC |
| InChI | InChI=1S/C27H50N2O4/c1-11-16-17-27(13-3,14-4)26(32)28-23(20(8)12-2)24(30)29(10)22(19(6)7)18-21(9)25(31)33-15-5/h18-20,22-23H,11-17H2,1-10H3,(H,28,32)/b21-18+/t20-,22+,23-/m0/s1 |
| InChIKey | MVJUSXFRNYRAPG-JBSGCLPBSA-N |
| XLogP | 5.51 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.71 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|