C19H33N3O4 — CID 71099072
ethyl (E,4S)-2,5-dimethyl-4-[methyl-[2-(piperidine-4-carbonylamino)acetyl]amino]hex-2-enoate (PubChem CID 71099072) has the molecular formula C19H33N3O4 and a molecular weight of 367.49 g/mol. Its IUPAC name is ethyl (E,4S)-2,5-dimethyl-4-[methyl-[2-(piperidine-4-carbonylamino)acetyl]amino]hex-2-enoate.
| Compound Name | ethyl (E,4S)-2,5-dimethyl-4-[methyl-[2-(piperidine-4-carbonylamino)acetyl]amino]hex-2-enoate |
|---|---|
| PubChem CID | 71099072 |
| Molecular Formula | C19H33N3O4 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | ethyl (E,4S)-2,5-dimethyl-4-[methyl-[2-(piperidine-4-carbonylamino)acetyl]amino]hex-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/[C@H](C(C)C)N(C)C(=O)CNC(=O)C1CCNCC1 |
| InChI | InChI=1S/C19H33N3O4/c1-6-26-19(25)14(4)11-16(13(2)3)22(5)17(23)12-21-18(24)15-7-9-20-10-8-15/h11,13,15-16,20H,6-10,12H2,1-5H3,(H,21,24)/b14-11+/t16-/m1/s1 |
| InChIKey | JDTCFPJHYFCKAC-WSYSLRRZSA-N |
| XLogP | 1.09 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|