C27H44N2O4 — CID 159047631
ethyl (E,4S)-2,5-dimethyl-4-[methyl-[2-[(2-methyl-2-phenylpropanoyl)amino]acetyl]amino]hex-2-enoate;2-methylpropane (PubChem CID 159047631) has the molecular formula C27H44N2O4 and a molecular weight of 460.66 g/mol. Its IUPAC name is ethyl (E,4S)-2,5-dimethyl-4-[methyl-[2-[(2-methyl-2-phenylpropanoyl)amino]acetyl]amino]hex-2-enoate;2-methylpropane.
| Compound Name | ethyl (E,4S)-2,5-dimethyl-4-[methyl-[2-[(2-methyl-2-phenylpropanoyl)amino]acetyl]amino]hex-2-enoate;2-methylpropane |
|---|---|
| PubChem CID | 159047631 |
| Molecular Formula | C27H44N2O4 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.33 |
| IUPAC Name | ethyl (E,4S)-2,5-dimethyl-4-[methyl-[2-[(2-methyl-2-phenylpropanoyl)amino]acetyl]amino]hex-2-enoate;2-methylpropane |
| SMILES | CC(C)C.CCOC(=O)/C(C)=C/[C@H](C(C)C)N(C)C(=O)CNC(=O)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C23H34N2O4.C4H10/c1-8-29-21(27)17(4)14-19(16(2)3)25(7)20(26)15-24-22(28)23(5,6)18-12-10-9-11-13-18;1-4(2)3/h9-14,16,19H,8,15H2,1-7H3,(H,24,28);4H,1-3H3/b17-14+;/t19-;/m1./s1 |
| InChIKey | JWVVXZVPBPRXTC-BCGUDBEGSA-N |
| XLogP | 4.74 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|