C19H36N4O4 — CID 123488241
ethyl (4S)-4-[[2-[[(tert-butylamino)-methylcarbamoyl]amino]acetyl]-methylamino]-2,5-dimethylhex-2-enoate (PubChem CID 123488241) has the molecular formula C19H36N4O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is ethyl (4S)-4-[[2-[[(tert-butylamino)-methylcarbamoyl]amino]acetyl]-methylamino]-2,5-dimethylhex-2-enoate.
| Compound Name | ethyl (4S)-4-[[2-[[(tert-butylamino)-methylcarbamoyl]amino]acetyl]-methylamino]-2,5-dimethylhex-2-enoate |
|---|---|
| PubChem CID | 123488241 |
| Molecular Formula | C19H36N4O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | ethyl (4S)-4-[[2-[[(tert-butylamino)-methylcarbamoyl]amino]acetyl]-methylamino]-2,5-dimethylhex-2-enoate |
| SMILES | CCOC(=O)C(C)=C[C@H](C(C)C)N(C)C(=O)CNC(=O)N(C)NC(C)(C)C |
| InChI | InChI=1S/C19H36N4O4/c1-10-27-17(25)14(4)11-15(13(2)3)22(8)16(24)12-20-18(26)23(9)21-19(5,6)7/h11,13,15,21H,10,12H2,1-9H3,(H,20,26)/t15-/m1/s1 |
| InChIKey | FWCLRSBDKCKJPV-OAHLLOKOSA-N |
| XLogP | 1.92 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|