C30H49N3O4 — CID 159005859
ethyl (E,4S)-4-[[2-[(1-benzylpiperidine-2-carbonyl)amino]acetyl]-methylamino]-2,5-dimethylhex-2-enoate;2-methylpropane (PubChem CID 159005859) has the molecular formula C30H49N3O4 and a molecular weight of 515.74 g/mol. Its IUPAC name is ethyl (E,4S)-4-[[2-[(1-benzylpiperidine-2-carbonyl)amino]acetyl]-methylamino]-2,5-dimethylhex-2-enoate;2-methylpropane.
| Compound Name | ethyl (E,4S)-4-[[2-[(1-benzylpiperidine-2-carbonyl)amino]acetyl]-methylamino]-2,5-dimethylhex-2-enoate;2-methylpropane |
|---|---|
| PubChem CID | 159005859 |
| Molecular Formula | C30H49N3O4 |
| Molecular Weight | 515.74 g/mol |
| Exact Mass | 515.37 |
| IUPAC Name | ethyl (E,4S)-4-[[2-[(1-benzylpiperidine-2-carbonyl)amino]acetyl]-methylamino]-2,5-dimethylhex-2-enoate;2-methylpropane |
| SMILES | CC(C)C.CCOC(=O)/C(C)=C/[C@H](C(C)C)N(C)C(=O)CNC(=O)C1CCCCN1Cc1ccccc1 |
| InChI | InChI=1S/C26H39N3O4.C4H10/c1-6-33-26(32)20(4)16-23(19(2)3)28(5)24(30)17-27-25(31)22-14-10-11-15-29(22)18-21-12-8-7-9-13-21;1-4(2)3/h7-9,12-13,16,19,22-23H,6,10-11,14-15,17-18H2,1-5H3,(H,27,31);4H,1-3H3/b20-16+;/t22?,23-;/m1./s1 |
| InChIKey | JRXITCVBUWBGFJ-WDUOIBBOSA-N |
| XLogP | 4.81 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.74 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|