C30H47N3O4 — CID 143024010
ethyl (E,4S)-4-[[2-[(1-benzylpiperidine-2-carbonyl)amino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoate (PubChem CID 143024010) has the molecular formula C30H47N3O4 and a molecular weight of 513.72 g/mol. Its IUPAC name is ethyl (E,4S)-4-[[2-[(1-benzylpiperidine-2-carbonyl)amino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoate.
| Compound Name | ethyl (E,4S)-4-[[2-[(1-benzylpiperidine-2-carbonyl)amino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoate |
|---|---|
| PubChem CID | 143024010 |
| Molecular Formula | C30H47N3O4 |
| Molecular Weight | 513.72 g/mol |
| Exact Mass | 513.36 |
| IUPAC Name | ethyl (E,4S)-4-[[2-[(1-benzylpiperidine-2-carbonyl)amino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/[C@H](C(C)C)N(C)C(=O)C(NC(=O)C1CCCCN1Cc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H47N3O4/c1-9-37-29(36)22(4)19-25(21(2)3)32(8)28(35)26(30(5,6)7)31-27(34)24-17-13-14-18-33(24)20-23-15-11-10-12-16-23/h10-12,15-16,19,21,24-26H,9,13-14,17-18,20H2,1-8H3,(H,31,34)/b22-19+/t24?,25-,26?/m1/s1 |
| InChIKey | JPENCIFMZGUVNV-ZNSIZKDJSA-N |
| XLogP | 4.56 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.72 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|