C24H33N3O5 — CID 89273292
benzyl (2S)-1-[(E)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]pyrrolidine-2-carboxylate (PubChem CID 89273292) has the molecular formula C24H33N3O5 and a molecular weight of 443.54 g/mol. Its IUPAC name is benzyl (2S)-1-[(E)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]pyrrolidine-2-carboxylate.
| Compound Name | benzyl (2S)-1-[(E)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 89273292 |
| Molecular Formula | C24H33N3O5 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | benzyl (2S)-1-[(E)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]pyrrolidine-2-carboxylate |
| SMILES | C/C(=C\C(C(C)C)N(C)C(=O)CNC=O)C(=O)N1CCC[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H33N3O5/c1-17(2)21(26(4)22(29)14-25-16-28)13-18(3)23(30)27-12-8-11-20(27)24(31)32-15-19-9-6-5-7-10-19/h5-7,9-10,13,16-17,20-21H,8,11-12,14-15H2,1-4H3,(H,25,28)/b18-13+/t20-,21?/m0/s1 |
| InChIKey | MWQNMQOOCSDPKY-DABLDATRSA-N |
| XLogP | 1.90 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|