C25H36N4O5 — CID 123572637
(2S)-1-[4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]-N-(2-hydroxy-1-phenylethyl)pyrrolidine-2-carboxamide (PubChem CID 123572637) has the molecular formula C25H36N4O5 and a molecular weight of 472.59 g/mol. Its IUPAC name is (2S)-1-[4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]-N-(2-hydroxy-1-phenylethyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]-N-(2-hydroxy-1-phenylethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 123572637 |
| Molecular Formula | C25H36N4O5 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | (2S)-1-[4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]-N-(2-hydroxy-1-phenylethyl)pyrrolidine-2-carboxamide |
| SMILES | CC(=CC(C(C)C)N(C)C(=O)CNC=O)C(=O)N1CCC[C@H]1C(=O)NC(CO)c1ccccc1 |
| InChI | InChI=1S/C25H36N4O5/c1-17(2)22(28(4)23(32)14-26-16-31)13-18(3)25(34)29-12-8-11-21(29)24(33)27-20(15-30)19-9-6-5-7-10-19/h5-7,9-10,13,16-17,20-22,30H,8,11-12,14-15H2,1-4H3,(H,26,31)(H,27,33)/t20?,21-,22?/m0/s1 |
| InChIKey | SCSDSHNAWOFSKT-ORFBVSJDSA-N |
| XLogP | 1.00 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|