C24H42N4O4 — CID 123651066
(2S)-1-[(4S)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]-N-heptylpyrrolidine-2-carboxamide (PubChem CID 123651066) has the molecular formula C24H42N4O4 and a molecular weight of 450.62 g/mol. Its IUPAC name is (2S)-1-[(4S)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]-N-heptylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(4S)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]-N-heptylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 123651066 |
| Molecular Formula | C24H42N4O4 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.32 |
| IUPAC Name | (2S)-1-[(4S)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]-N-heptylpyrrolidine-2-carboxamide |
| SMILES | CCCCCCCNC(=O)[C@@H]1CCCN1C(=O)C(C)=C[C@H](C(C)C)N(C)C(=O)CNC=O |
| InChI | InChI=1S/C24H42N4O4/c1-6-7-8-9-10-13-26-23(31)20-12-11-14-28(20)24(32)19(4)15-21(18(2)3)27(5)22(30)16-25-17-29/h15,17-18,20-21H,6-14,16H2,1-5H3,(H,25,29)(H,26,31)/t20-,21+/m0/s1 |
| InChIKey | ZTTXBPPSXIHELS-LEWJYISDSA-N |
| XLogP | 2.24 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|