C21H35N3O5 — CID 123566388
tert-butyl (2S)-1-[4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]pyrrolidine-2-carboxylate (PubChem CID 123566388) has the molecular formula C21H35N3O5 and a molecular weight of 409.53 g/mol. Its IUPAC name is tert-butyl (2S)-1-[4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 123566388 |
| Molecular Formula | C21H35N3O5 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | tert-butyl (2S)-1-[4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]pyrrolidine-2-carboxylate |
| SMILES | CC(=CC(C(C)C)N(C)C(=O)CNC=O)C(=O)N1CCC[C@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H35N3O5/c1-14(2)17(23(7)18(26)12-22-13-25)11-15(3)19(27)24-10-8-9-16(24)20(28)29-21(4,5)6/h11,13-14,16-17H,8-10,12H2,1-7H3,(H,22,25)/t16-,17?/m0/s1 |
| InChIKey | YYYSATNHUDWBOC-BHWOMJMDSA-N |
| XLogP | 1.49 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|