C26H38N4O4 — CID 123467758
(2S)-1-[(4S)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]-N-(1-phenylpropan-2-yl)pyrrolidine-2-carboxamide (PubChem CID 123467758) has the molecular formula C26H38N4O4 and a molecular weight of 470.61 g/mol. Its IUPAC name is (2S)-1-[(4S)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]-N-(1-phenylpropan-2-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(4S)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]-N-(1-phenylpropan-2-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 123467758 |
| Molecular Formula | C26H38N4O4 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | (2S)-1-[(4S)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]-N-(1-phenylpropan-2-yl)pyrrolidine-2-carboxamide |
| SMILES | CC(=C[C@H](C(C)C)N(C)C(=O)CNC=O)C(=O)N1CCC[C@H]1C(=O)NC(C)Cc1ccccc1 |
| InChI | InChI=1S/C26H38N4O4/c1-18(2)23(29(5)24(32)16-27-17-31)14-19(3)26(34)30-13-9-12-22(30)25(33)28-20(4)15-21-10-7-6-8-11-21/h6-8,10-11,14,17-18,20,22-23H,9,12-13,15-16H2,1-5H3,(H,27,31)(H,28,33)/t20?,22-,23+/m0/s1 |
| InChIKey | YRTCVCOFIQPEOI-XGELLPRESA-N |
| XLogP | 1.90 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|