C25H32N4O4 — CID 89273414
(2S)-N-(4-ethynylphenyl)-1-[(E)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]pyrrolidine-2-carboxamide (PubChem CID 89273414) has the molecular formula C25H32N4O4 and a molecular weight of 452.56 g/mol. Its IUPAC name is (2S)-N-(4-ethynylphenyl)-1-[(E)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(4-ethynylphenyl)-1-[(E)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 89273414 |
| Molecular Formula | C25H32N4O4 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | (2S)-N-(4-ethynylphenyl)-1-[(E)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]pyrrolidine-2-carboxamide |
| SMILES | C#Cc1ccc(NC(=O)[C@@H]2CCCN2C(=O)/C(C)=C/C(C(C)C)N(C)C(=O)CNC=O)cc1 |
| InChI | InChI=1S/C25H32N4O4/c1-6-19-9-11-20(12-10-19)27-24(32)21-8-7-13-29(21)25(33)18(4)14-22(17(2)3)28(5)23(31)15-26-16-30/h1,9-12,14,16-17,21-22H,7-8,13,15H2,2-5H3,(H,26,30)(H,27,32)/b18-14+/t21-,22?/m0/s1 |
| InChIKey | YYVLMVNZMVMNLZ-OMPRQEODSA-N |
| XLogP | 1.77 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|