C29H55N3O4 — CID 160547610
1-(1-cyclobutylethyl)piperidine;ethyl (E,4S)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoate;2-methylpropane (PubChem CID 160547610) has the molecular formula C29H55N3O4 and a molecular weight of 509.78 g/mol. Its IUPAC name is 1-(1-cyclobutylethyl)piperidine;ethyl (E,4S)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoate;2-methylpropane.
| Compound Name | 1-(1-cyclobutylethyl)piperidine;ethyl (E,4S)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoate;2-methylpropane |
|---|---|
| PubChem CID | 160547610 |
| Molecular Formula | C29H55N3O4 |
| Molecular Weight | 509.78 g/mol |
| Exact Mass | 509.42 |
| IUPAC Name | 1-(1-cyclobutylethyl)piperidine;ethyl (E,4S)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoate;2-methylpropane |
| SMILES | CC(C)C.CC(C1CCC1)N1CCCCC1.CCOC(=O)/C(C)=C/[C@H](C(C)C)N(C)C(=O)CNC=O |
| InChI | InChI=1S/C14H24N2O4.C11H21N.C4H10/c1-6-20-14(19)11(4)7-12(10(2)3)16(5)13(18)8-15-9-17;1-10(11-6-5-7-11)12-8-3-2-4-9-12;1-4(2)3/h7,9-10,12H,6,8H2,1-5H3,(H,15,17);10-11H,2-9H2,1H3;4H,1-3H3/b11-7+;;/t12-;;/m1../s1 |
| InChIKey | QXQFDHSQSNLTPO-YPAWVDPYSA-N |
| XLogP | 5.05 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.78 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|