C29H53N3O5 — CID 161039194
methyl (1R)-2-[(E,4S)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]cyclopentane-1-carboxylate;1-methylpiperidine;2-methylpropane (PubChem CID 161039194) has the molecular formula C29H53N3O5 and a molecular weight of 523.76 g/mol. Its IUPAC name is methyl (1R)-2-[(E,4S)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]cyclopentane-1-carboxylate;1-methylpiperidine;2-methylpropane.
| Compound Name | methyl (1R)-2-[(E,4S)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]cyclopentane-1-carboxylate;1-methylpiperidine;2-methylpropane |
|---|---|
| PubChem CID | 161039194 |
| Molecular Formula | C29H53N3O5 |
| Molecular Weight | 523.76 g/mol |
| Exact Mass | 523.40 |
| IUPAC Name | methyl (1R)-2-[(E,4S)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]cyclopentane-1-carboxylate;1-methylpiperidine;2-methylpropane |
| SMILES | CC(C)C.CN1CCCCC1.COC(=O)[C@@H]1CCCC1C(=O)/C(C)=C/[C@H](C(C)C)N(C)C(=O)CNC=O |
| InChI | InChI=1S/C19H30N2O5.C6H13N.C4H10/c1-12(2)16(21(4)17(23)10-20-11-22)9-13(3)18(24)14-7-6-8-15(14)19(25)26-5;1-7-5-3-2-4-6-7;1-4(2)3/h9,11-12,14-16H,6-8,10H2,1-5H3,(H,20,22);2-6H2,1H3;4H,1-3H3/b13-9+;;/t14?,15-,16-;;/m1../s1 |
| InChIKey | UAQVACOFXCLLEB-NBKNGGFNSA-N |
| XLogP | 4.08 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.76 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|