C12H20N2O4 — CID 123762567
4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoic acid (PubChem CID 123762567) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is 4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoic acid.
| Compound Name | 4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoic acid |
|---|---|
| PubChem CID | 123762567 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoic acid |
| SMILES | CC(=CC(C(C)C)N(C)C(=O)CNC=O)C(=O)O |
| InChI | InChI=1S/C12H20N2O4/c1-8(2)10(5-9(3)12(17)18)14(4)11(16)6-13-7-15/h5,7-8,10H,6H2,1-4H3,(H,13,15)(H,17,18) |
| InChIKey | HJJDYZWRWCJIDS-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|