C13H23N3O3 — CID 123780074
(4S)-4-[(2-formamidoacetyl)-methylamino]-N,2,5-trimethylhex-2-enamide (PubChem CID 123780074) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is (4S)-4-[(2-formamidoacetyl)-methylamino]-N,2,5-trimethylhex-2-enamide.
| Compound Name | (4S)-4-[(2-formamidoacetyl)-methylamino]-N,2,5-trimethylhex-2-enamide |
|---|---|
| PubChem CID | 123780074 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | (4S)-4-[(2-formamidoacetyl)-methylamino]-N,2,5-trimethylhex-2-enamide |
| SMILES | CNC(=O)C(C)=C[C@H](C(C)C)N(C)C(=O)CNC=O |
| InChI | InChI=1S/C13H23N3O3/c1-9(2)11(6-10(3)13(19)14-4)16(5)12(18)7-15-8-17/h6,8-9,11H,7H2,1-5H3,(H,14,19)(H,15,17)/t11-/m1/s1 |
| InChIKey | YABZCOBSNNYCGU-LLVKDONJSA-N |
| XLogP | -0.09 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|