C15H25N3O3S — CID 89273389
N-[(E,3S)-2,5-dimethyl-6-oxo-6-(1,3-thiazolidin-3-yl)hex-4-en-3-yl]-2-formamido-N-methylacetamide (PubChem CID 89273389) has the molecular formula C15H25N3O3S and a molecular weight of 327.45 g/mol. Its IUPAC name is N-[(E,3S)-2,5-dimethyl-6-oxo-6-(1,3-thiazolidin-3-yl)hex-4-en-3-yl]-2-formamido-N-methylacetamide.
| Compound Name | N-[(E,3S)-2,5-dimethyl-6-oxo-6-(1,3-thiazolidin-3-yl)hex-4-en-3-yl]-2-formamido-N-methylacetamide |
|---|---|
| PubChem CID | 89273389 |
| Molecular Formula | C15H25N3O3S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | N-[(E,3S)-2,5-dimethyl-6-oxo-6-(1,3-thiazolidin-3-yl)hex-4-en-3-yl]-2-formamido-N-methylacetamide |
| SMILES | C/C(=C\[C@H](C(C)C)N(C)C(=O)CNC=O)C(=O)N1CCSC1 |
| InChI | InChI=1S/C15H25N3O3S/c1-11(2)13(17(4)14(20)8-16-9-19)7-12(3)15(21)18-5-6-22-10-18/h7,9,11,13H,5-6,8,10H2,1-4H3,(H,16,19)/b12-7+/t13-/m1/s1 |
| InChIKey | OYCQGWMJXADWQT-BWODNOAJSA-N |
| XLogP | 0.69 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|