C22H31ClN4O3 — CID 123910612
N-[6-[4-(2-chlorophenyl)piperazin-1-yl]-2,5-dimethyl-6-oxohex-4-en-3-yl]-2-formamido-N-methylacetamide (PubChem CID 123910612) has the molecular formula C22H31ClN4O3 and a molecular weight of 434.97 g/mol. Its IUPAC name is N-[6-[4-(2-chlorophenyl)piperazin-1-yl]-2,5-dimethyl-6-oxohex-4-en-3-yl]-2-formamido-N-methylacetamide.
| Compound Name | N-[6-[4-(2-chlorophenyl)piperazin-1-yl]-2,5-dimethyl-6-oxohex-4-en-3-yl]-2-formamido-N-methylacetamide |
|---|---|
| PubChem CID | 123910612 |
| Molecular Formula | C22H31ClN4O3 |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | N-[6-[4-(2-chlorophenyl)piperazin-1-yl]-2,5-dimethyl-6-oxohex-4-en-3-yl]-2-formamido-N-methylacetamide |
| SMILES | CC(=CC(C(C)C)N(C)C(=O)CNC=O)C(=O)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C22H31ClN4O3/c1-16(2)20(25(4)21(29)14-24-15-28)13-17(3)22(30)27-11-9-26(10-12-27)19-8-6-5-7-18(19)23/h5-8,13,15-16,20H,9-12,14H2,1-4H3,(H,24,28) |
| InChIKey | OEDKNRDPLYETPD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|