C29H54N4O5 — CID 157167035
1-[(E,4S)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]piperidine-4-carboxylic acid;propane;1-propan-2-ylpiperidine (PubChem CID 157167035) has the molecular formula C29H54N4O5 and a molecular weight of 538.77 g/mol. Its IUPAC name is 1-[(E,4S)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]piperidine-4-carboxylic acid;propane;1-propan-2-ylpiperidine.
| Compound Name | 1-[(E,4S)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]piperidine-4-carboxylic acid;propane;1-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 157167035 |
| Molecular Formula | C29H54N4O5 |
| Molecular Weight | 538.77 g/mol |
| Exact Mass | 538.41 |
| IUPAC Name | 1-[(E,4S)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoyl]piperidine-4-carboxylic acid;propane;1-propan-2-ylpiperidine |
| SMILES | C/C(=C\[C@H](C(C)C)N(C)C(=O)CNC=O)C(=O)N1CCC(C(=O)O)CC1.CC(C)N1CCCCC1.CCC |
| InChI | InChI=1S/C18H29N3O5.C8H17N.C3H8/c1-12(2)15(20(4)16(23)10-19-11-22)9-13(3)17(24)21-7-5-14(6-8-21)18(25)26;1-8(2)9-6-4-3-5-7-9;1-3-2/h9,11-12,14-15H,5-8,10H2,1-4H3,(H,19,22)(H,25,26);8H,3-7H2,1-2H3;3H2,1-2H3/b13-9+;;/t15-;;/m1../s1 |
| InChIKey | ANAOWALPNPWRTQ-QWCBPPLGSA-N |
| XLogP | 3.78 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.77 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|