C17H28BrN3O3 — CID 89273312
N-[(E,3S)-6-(4-bromopiperidin-1-yl)-2,5-dimethyl-6-oxohex-4-en-3-yl]-2-formamido-N-methylacetamide (PubChem CID 89273312) has the molecular formula C17H28BrN3O3 and a molecular weight of 402.33 g/mol. Its IUPAC name is N-[(E,3S)-6-(4-bromopiperidin-1-yl)-2,5-dimethyl-6-oxohex-4-en-3-yl]-2-formamido-N-methylacetamide.
| Compound Name | N-[(E,3S)-6-(4-bromopiperidin-1-yl)-2,5-dimethyl-6-oxohex-4-en-3-yl]-2-formamido-N-methylacetamide |
|---|---|
| PubChem CID | 89273312 |
| Molecular Formula | C17H28BrN3O3 |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | N-[(E,3S)-6-(4-bromopiperidin-1-yl)-2,5-dimethyl-6-oxohex-4-en-3-yl]-2-formamido-N-methylacetamide |
| SMILES | C/C(=C\[C@H](C(C)C)N(C)C(=O)CNC=O)C(=O)N1CCC(Br)CC1 |
| InChI | InChI=1S/C17H28BrN3O3/c1-12(2)15(20(4)16(23)10-19-11-22)9-13(3)17(24)21-7-5-14(18)6-8-21/h9,11-12,14-15H,5-8,10H2,1-4H3,(H,19,22)/b13-9+/t15-/m1/s1 |
| InChIKey | MOFJHFXSORQFHS-BMQCOBNYSA-N |
| XLogP | 1.55 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|