C25H45N3O4 — CID 158079545
(E,4S)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoic acid;1-(2-methylbut-3-yn-2-yl)piperidine;propane (PubChem CID 158079545) has the molecular formula C25H45N3O4 and a molecular weight of 451.65 g/mol. Its IUPAC name is (E,4S)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoic acid;1-(2-methylbut-3-yn-2-yl)piperidine;propane.
| Compound Name | (E,4S)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoic acid;1-(2-methylbut-3-yn-2-yl)piperidine;propane |
|---|---|
| PubChem CID | 158079545 |
| Molecular Formula | C25H45N3O4 |
| Molecular Weight | 451.65 g/mol |
| Exact Mass | 451.34 |
| IUPAC Name | (E,4S)-4-[(2-formamidoacetyl)-methylamino]-2,5-dimethylhex-2-enoic acid;1-(2-methylbut-3-yn-2-yl)piperidine;propane |
| SMILES | C#CC(C)(C)N1CCCCC1.C/C(=C\[C@H](C(C)C)N(C)C(=O)CNC=O)C(=O)O.CCC |
| InChI | InChI=1S/C12H20N2O4.C10H17N.C3H8/c1-8(2)10(5-9(3)12(17)18)14(4)11(16)6-13-7-15;1-4-10(2,3)11-8-6-5-7-9-11;1-3-2/h5,7-8,10H,6H2,1-4H3,(H,13,15)(H,17,18);1H,5-9H2,2-3H3;3H2,1-2H3/b9-5+;;/t10-;;/m1../s1 |
| InChIKey | FMTYWXALTNOZIK-QAZFYXNSSA-N |
| XLogP | 3.55 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.65 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|