C19H34N2O4 — CID 158369721
(E,4S)-4-[[2-(2,2-diethylbutanoylamino)acetyl]-methylamino]-2,5-dimethylhex-2-enoic acid (PubChem CID 158369721) has the molecular formula C19H34N2O4 and a molecular weight of 354.49 g/mol. Its IUPAC name is (E,4S)-4-[[2-(2,2-diethylbutanoylamino)acetyl]-methylamino]-2,5-dimethylhex-2-enoic acid.
| Compound Name | (E,4S)-4-[[2-(2,2-diethylbutanoylamino)acetyl]-methylamino]-2,5-dimethylhex-2-enoic acid |
|---|---|
| PubChem CID | 158369721 |
| Molecular Formula | C19H34N2O4 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | (E,4S)-4-[[2-(2,2-diethylbutanoylamino)acetyl]-methylamino]-2,5-dimethylhex-2-enoic acid |
| SMILES | CCC(CC)(CC)C(=O)NCC(=O)N(C)[C@H](/C=C(\C)C(=O)O)C(C)C |
| InChI | InChI=1S/C19H34N2O4/c1-8-19(9-2,10-3)18(25)20-12-16(22)21(7)15(13(4)5)11-14(6)17(23)24/h11,13,15H,8-10,12H2,1-7H3,(H,20,25)(H,23,24)/b14-11+/t15-/m1/s1 |
| InChIKey | PAZKXPHKGBYHQD-ATGUSINASA-N |
| XLogP | 2.83 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|