C22H32N2O4 — CID 161300643
(E)-4-[[2-(2-benzylbutanoylamino)acetyl]-methylamino]-2,5-dimethylhex-2-enoic acid (PubChem CID 161300643) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is (E)-4-[[2-(2-benzylbutanoylamino)acetyl]-methylamino]-2,5-dimethylhex-2-enoic acid.
| Compound Name | (E)-4-[[2-(2-benzylbutanoylamino)acetyl]-methylamino]-2,5-dimethylhex-2-enoic acid |
|---|---|
| PubChem CID | 161300643 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | (E)-4-[[2-(2-benzylbutanoylamino)acetyl]-methylamino]-2,5-dimethylhex-2-enoic acid |
| SMILES | CCC(Cc1ccccc1)C(=O)NCC(=O)N(C)C(/C=C(\C)C(=O)O)C(C)C |
| InChI | InChI=1S/C22H32N2O4/c1-6-18(13-17-10-8-7-9-11-17)21(26)23-14-20(25)24(5)19(15(2)3)12-16(4)22(27)28/h7-12,15,18-19H,6,13-14H2,1-5H3,(H,23,26)(H,27,28)/b16-12+ |
| InChIKey | PYCQEONBSUQNNC-FOWTUZBSSA-N |
| XLogP | 2.89 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|