C19H27N3O4 — CID 123634876
(4S)-4-[[2-[[3-(aminomethyl)benzoyl]amino]acetyl]-methylamino]-2,5-dimethylhex-2-enoic acid (PubChem CID 123634876) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is (4S)-4-[[2-[[3-(aminomethyl)benzoyl]amino]acetyl]-methylamino]-2,5-dimethylhex-2-enoic acid.
| Compound Name | (4S)-4-[[2-[[3-(aminomethyl)benzoyl]amino]acetyl]-methylamino]-2,5-dimethylhex-2-enoic acid |
|---|---|
| PubChem CID | 123634876 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | (4S)-4-[[2-[[3-(aminomethyl)benzoyl]amino]acetyl]-methylamino]-2,5-dimethylhex-2-enoic acid |
| SMILES | CC(=C[C@H](C(C)C)N(C)C(=O)CNC(=O)c1cccc(CN)c1)C(=O)O |
| InChI | InChI=1S/C19H27N3O4/c1-12(2)16(8-13(3)19(25)26)22(4)17(23)11-21-18(24)15-7-5-6-14(9-15)10-20/h5-9,12,16H,10-11,20H2,1-4H3,(H,21,24)(H,25,26)/t16-/m1/s1 |
| InChIKey | OSUYMBYUUYEEOE-MRXNPFEDSA-N |
| XLogP | 1.39 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|