About (4S)-4-[[2-[[3-(aminomethyl)benzoyl]amino]acetyl]-methylamino]-2,5-dimethylhex-2-enoic acid
(4S)-4-[[2-[[3-(aminomethyl)benzoyl]amino]acetyl]-methylamino]-2,5-dimethylhex-2-enoic acid (PubChem CID 123634876) has the molecular formula C19H27N3O4
and a molecular weight of 361.44 g/mol. Its IUPAC name is (4S)-4-[[2-[[3-(aminomethyl)benzoyl]amino]acetyl]-methylamino]-2,5-dimethylhex-2-enoic acid.
Molecular Properties
| Compound Name | (4S)-4-[[2-[[3-(aminomethyl)benzoyl]amino]acetyl]-methylamino]-2,5-dimethylhex-2-enoic acid |
| PubChem CID | 123634876 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | (4S)-4-[[2-[[3-(aminomethyl)benzoyl]amino]acetyl]-methylamino]-2,5-dimethylhex-2-enoic acid |
| SMILES | CC(=C[C@H](C(C)C)N(C)C(=O)CNC(=O)c1cccc(CN)c1)C(=O)O |
| InChI | InChI=1S/C19H27N3O4/c1-12(2)16(8-13(3)19(25)26)22(4)17(23)11-21-18(24)15-7-5-6-14(9-15)10-20/h5-9,12,16H,10-11,20H2,1-4H3,(H,21,24)(H,25,26)/t16-/m1/s1 |
| InChIKey | OSUYMBYUUYEEOE-MRXNPFEDSA-N |
| XLogP | 1.39 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-[[2-[[3-(aminomethyl)benzoyl]amino]acetyl]-methylamino]-2,5-dimethylhex-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-[[2-[[3-(aminomethyl)benzoyl]amino]acetyl]-methylamino]-2,5-dimethylhex-2-enoic acid?
The IUPAC name of (4S)-4-[[2-[[3-(aminomethyl)benzoyl]amino]acetyl]-methylamino]-2,5-dimethylhex-2-enoic acid (CID 123634876) is (4S)-4-[[2-[[3-(aminomethyl)benzoyl]amino]acetyl]-methylamino]-2,5-dimethylhex-2-enoic acid.
What is the SMILES notation for (4S)-4-[[2-[[3-(aminomethyl)benzoyl]amino]acetyl]-methylamino]-2,5-dimethylhex-2-enoic acid?
The canonical SMILES for (4S)-4-[[2-[[3-(aminomethyl)benzoyl]amino]acetyl]-methylamino]-2,5-dimethylhex-2-enoic acid is CC(=C[C@H](C(C)C)N(C)C(=O)CNC(=O)c1cccc(CN)c1)C(=O)O.
What is the InChIKey of (4S)-4-[[2-[[3-(aminomethyl)benzoyl]amino]acetyl]-methylamino]-2,5-dimethylhex-2-enoic acid?
The InChIKey is OSUYMBYUUYEEOE-MRXNPFEDSA-N. The full InChI is InChI=1S/C19H27N3O4/c1-12(2)16(8-13(3)19(25)26)22(4)17(23)11-21-18(24)15-7-5-6-14(9-15)10-20/h5-9,12,16H,10-11,20H2,1-4H3,(H,21,24)(H,25,26)/t16-/m1/s1.
What are the key properties of (4S)-4-[[2-[[3-(aminomethyl)benzoyl]amino]acetyl]-methylamino]-2,5-dimethylhex-2-enoic acid?
(4S)-4-[[2-[[3-(aminomethyl)benzoyl]amino]acetyl]-methylamino]-2,5-dimethylhex-2-enoic acid has a molecular weight of 361.44 g/mol, XLogP of 1.39, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-[[2-[[3-(aminomethyl)benzoyl]amino]acetyl]-methylamino]-2,5-dimethylhex-2-enoic acid is sourced from PubChem (CID 123634876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).