C16H26N2O — CID 115161209
3-(aminomethyl)-N-(2,2,4-trimethylpentyl)benzamide (PubChem CID 115161209) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(2,2,4-trimethylpentyl)benzamide.
| Compound Name | 3-(aminomethyl)-N-(2,2,4-trimethylpentyl)benzamide |
|---|---|
| PubChem CID | 115161209 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 3-(aminomethyl)-N-(2,2,4-trimethylpentyl)benzamide |
| SMILES | CC(C)CC(C)(C)CNC(=O)c1cccc(CN)c1 |
| InChI | InChI=1S/C16H26N2O/c1-12(2)9-16(3,4)11-18-15(19)14-7-5-6-13(8-14)10-17/h5-8,12H,9-11,17H2,1-4H3,(H,18,19) |
| InChIKey | TVFUCPYWFZQZER-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |