C11H12F4N2O — CID 106289370
3-(aminomethyl)-N-(2,2,3,3-tetrafluoropropyl)benzamide (PubChem CID 106289370) has the molecular formula C11H12F4N2O and a molecular weight of 264.22 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(2,2,3,3-tetrafluoropropyl)benzamide.
| Compound Name | 3-(aminomethyl)-N-(2,2,3,3-tetrafluoropropyl)benzamide |
|---|---|
| PubChem CID | 106289370 |
| Molecular Formula | C11H12F4N2O |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 3-(aminomethyl)-N-(2,2,3,3-tetrafluoropropyl)benzamide |
| SMILES | NCc1cccc(C(=O)NCC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C11H12F4N2O/c12-10(13)11(14,15)6-17-9(18)8-3-1-2-7(4-8)5-16/h1-4,10H,5-6,16H2,(H,17,18) |
| InChIKey | WDFDEVAQPSRIBL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|