C10H9F4N3O3 — CID 106295547
3-amino-4-nitro-N-(2,2,3,3-tetrafluoropropyl)benzamide (PubChem CID 106295547) has the molecular formula C10H9F4N3O3 and a molecular weight of 295.19 g/mol. Its IUPAC name is 3-amino-4-nitro-N-(2,2,3,3-tetrafluoropropyl)benzamide.
| Compound Name | 3-amino-4-nitro-N-(2,2,3,3-tetrafluoropropyl)benzamide |
|---|---|
| PubChem CID | 106295547 |
| Molecular Formula | C10H9F4N3O3 |
| Molecular Weight | 295.19 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 3-amino-4-nitro-N-(2,2,3,3-tetrafluoropropyl)benzamide |
| SMILES | Nc1cc(C(=O)NCC(F)(F)C(F)F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H9F4N3O3/c11-9(12)10(13,14)4-16-8(18)5-1-2-7(17(19)20)6(15)3-5/h1-3,9H,4,15H2,(H,16,18) |
| InChIKey | JLTHGJZKGSDASE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.19 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|