C10H9N5O4 — CID 106408394
3-amino-4-nitro-N-(1,2,4-oxadiazol-3-ylmethyl)benzamide (PubChem CID 106408394) has the molecular formula C10H9N5O4 and a molecular weight of 263.21 g/mol. Its IUPAC name is 3-amino-4-nitro-N-(1,2,4-oxadiazol-3-ylmethyl)benzamide.
| Compound Name | 3-amino-4-nitro-N-(1,2,4-oxadiazol-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 106408394 |
| Molecular Formula | C10H9N5O4 |
| Molecular Weight | 263.21 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 3-amino-4-nitro-N-(1,2,4-oxadiazol-3-ylmethyl)benzamide |
| SMILES | Nc1cc(C(=O)NCc2ncon2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H9N5O4/c11-7-3-6(1-2-8(7)15(17)18)10(16)12-4-9-13-5-19-14-9/h1-3,5H,4,11H2,(H,12,16) |
| InChIKey | JYQCCEYGDFXUFE-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 137.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.21 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|