C11H10N4O4 — CID 106391440
6-amino-N-(1,2,4-oxadiazol-3-ylmethyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 106391440) has the molecular formula C11H10N4O4 and a molecular weight of 262.22 g/mol. Its IUPAC name is 6-amino-N-(1,2,4-oxadiazol-3-ylmethyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | 6-amino-N-(1,2,4-oxadiazol-3-ylmethyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 106391440 |
| Molecular Formula | C11H10N4O4 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 6-amino-N-(1,2,4-oxadiazol-3-ylmethyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | Nc1cc2c(cc1C(=O)NCc1ncon1)OCO2 |
| InChI | InChI=1S/C11H10N4O4/c12-7-2-9-8(17-5-18-9)1-6(7)11(16)13-3-10-14-4-19-15-10/h1-2,4H,3,5,12H2,(H,13,16) |
| InChIKey | KCMXWFLROHQBJU-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|