C11H14N2O5 — CID 103543245
6-amino-N-(2,3-dihydroxypropyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 103543245) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is 6-amino-N-(2,3-dihydroxypropyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | 6-amino-N-(2,3-dihydroxypropyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 103543245 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 6-amino-N-(2,3-dihydroxypropyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | Nc1cc2c(cc1C(=O)NCC(O)CO)OCO2 |
| InChI | InChI=1S/C11H14N2O5/c12-8-2-10-9(17-5-18-10)1-7(8)11(16)13-3-6(15)4-14/h1-2,6,14-15H,3-5,12H2,(H,13,16) |
| InChIKey | UGLHDSHWZSCCBX-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|