C12H16N2O5 — CID 103543329
6-amino-N-(1,3-dihydroxy-2-methylpropan-2-yl)-1,3-benzodioxole-5-carboxamide (PubChem CID 103543329) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is 6-amino-N-(1,3-dihydroxy-2-methylpropan-2-yl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | 6-amino-N-(1,3-dihydroxy-2-methylpropan-2-yl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 103543329 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 6-amino-N-(1,3-dihydroxy-2-methylpropan-2-yl)-1,3-benzodioxole-5-carboxamide |
| SMILES | CC(CO)(CO)NC(=O)c1cc2c(cc1N)OCO2 |
| InChI | InChI=1S/C12H16N2O5/c1-12(4-15,5-16)14-11(17)7-2-9-10(3-8(7)13)19-6-18-9/h2-3,15-16H,4-6,13H2,1H3,(H,14,17) |
| InChIKey | VPSUNOSUQGJTOV-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|