C10H11N3O4 — CID 103542763
6-amino-N-(2-amino-2-oxoethyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 103542763) has the molecular formula C10H11N3O4 and a molecular weight of 237.21 g/mol. Its IUPAC name is 6-amino-N-(2-amino-2-oxoethyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | 6-amino-N-(2-amino-2-oxoethyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 103542763 |
| Molecular Formula | C10H11N3O4 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 6-amino-N-(2-amino-2-oxoethyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | NC(=O)CNC(=O)c1cc2c(cc1N)OCO2 |
| InChI | InChI=1S/C10H11N3O4/c11-6-2-8-7(16-4-17-8)1-5(6)10(15)13-3-9(12)14/h1-2H,3-4,11H2,(H2,12,14)(H,13,15) |
| InChIKey | QCJMLLZBEUVXAL-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|