C11H10N4O4 — CID 103939713
4-amino-3-nitro-N-(1,2-oxazol-5-ylmethyl)benzamide (PubChem CID 103939713) has the molecular formula C11H10N4O4 and a molecular weight of 262.23 g/mol. Its IUPAC name is 4-amino-3-nitro-N-(1,2-oxazol-5-ylmethyl)benzamide.
| Compound Name | 4-amino-3-nitro-N-(1,2-oxazol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 103939713 |
| Molecular Formula | C11H10N4O4 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 4-amino-3-nitro-N-(1,2-oxazol-5-ylmethyl)benzamide |
| SMILES | Nc1ccc(C(=O)NCc2ccno2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H10N4O4/c12-9-2-1-7(5-10(9)15(17)18)11(16)13-6-8-3-4-14-19-8/h1-5H,6,12H2,(H,13,16) |
| InChIKey | XCWYPEBMPYXUII-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|