C11H8BrN3O4 — CID 106415796
2-bromo-5-nitro-N-(1,2-oxazol-5-ylmethyl)benzamide (PubChem CID 106415796) has the molecular formula C11H8BrN3O4 and a molecular weight of 326.11 g/mol. Its IUPAC name is 2-bromo-5-nitro-N-(1,2-oxazol-5-ylmethyl)benzamide.
| Compound Name | 2-bromo-5-nitro-N-(1,2-oxazol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 106415796 |
| Molecular Formula | C11H8BrN3O4 |
| Molecular Weight | 326.11 g/mol |
| Exact Mass | 324.97 |
| IUPAC Name | 2-bromo-5-nitro-N-(1,2-oxazol-5-ylmethyl)benzamide |
| SMILES | O=C(NCc1ccno1)c1cc([N+](=O)[O-])ccc1Br |
| InChI | InChI=1S/C11H8BrN3O4/c12-10-2-1-7(15(17)18)5-9(10)11(16)13-6-8-3-4-14-19-8/h1-5H,6H2,(H,13,16) |
| InChIKey | HYUBFLYRDFQOLV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.11 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|