C9H8F4N4O3 — CID 106295603
2-amino-5-nitro-N-(2,2,3,3-tetrafluoropropyl)pyridine-4-carboxamide (PubChem CID 106295603) has the molecular formula C9H8F4N4O3 and a molecular weight of 296.18 g/mol. Its IUPAC name is 2-amino-5-nitro-N-(2,2,3,3-tetrafluoropropyl)pyridine-4-carboxamide.
| Compound Name | 2-amino-5-nitro-N-(2,2,3,3-tetrafluoropropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 106295603 |
| Molecular Formula | C9H8F4N4O3 |
| Molecular Weight | 296.18 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 2-amino-5-nitro-N-(2,2,3,3-tetrafluoropropyl)pyridine-4-carboxamide |
| SMILES | Nc1cc(C(=O)NCC(F)(F)C(F)F)c([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C9H8F4N4O3/c10-8(11)9(12,13)3-16-7(18)4-1-6(14)15-2-5(4)17(19)20/h1-2,8H,3H2,(H2,14,15)(H,16,18) |
| InChIKey | PMRRWYYHKJLQMC-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.18 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|