C11H14ClN3O3 — CID 113250953
2-chloro-N-(2,2-dimethylpropyl)-5-nitropyridine-4-carboxamide (PubChem CID 113250953) has the molecular formula C11H14ClN3O3 and a molecular weight of 271.70 g/mol. Its IUPAC name is 2-chloro-N-(2,2-dimethylpropyl)-5-nitropyridine-4-carboxamide.
| Compound Name | 2-chloro-N-(2,2-dimethylpropyl)-5-nitropyridine-4-carboxamide |
|---|---|
| PubChem CID | 113250953 |
| Molecular Formula | C11H14ClN3O3 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 2-chloro-N-(2,2-dimethylpropyl)-5-nitropyridine-4-carboxamide |
| SMILES | CC(C)(C)CNC(=O)c1cc(Cl)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14ClN3O3/c1-11(2,3)6-14-10(16)7-4-9(12)13-5-8(7)15(17)18/h4-5H,6H2,1-3H3,(H,14,16) |
| InChIKey | FEGBKUMXARCFIM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|