C10H7ClN4O3S — CID 104583556
2-chloro-5-nitro-N-(1,3-thiazol-5-ylmethyl)pyridine-4-carboxamide (PubChem CID 104583556) has the molecular formula C10H7ClN4O3S and a molecular weight of 298.71 g/mol. Its IUPAC name is 2-chloro-5-nitro-N-(1,3-thiazol-5-ylmethyl)pyridine-4-carboxamide.
| Compound Name | 2-chloro-5-nitro-N-(1,3-thiazol-5-ylmethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 104583556 |
| Molecular Formula | C10H7ClN4O3S |
| Molecular Weight | 298.71 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | 2-chloro-5-nitro-N-(1,3-thiazol-5-ylmethyl)pyridine-4-carboxamide |
| SMILES | O=C(NCc1cncs1)c1cc(Cl)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H7ClN4O3S/c11-9-1-7(8(4-13-9)15(17)18)10(16)14-3-6-2-12-5-19-6/h1-2,4-5H,3H2,(H,14,16) |
| InChIKey | UIFXSDFQCVJANB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.71 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|